C20H27N3O2 — CID 122443269
3-(5-tert-butyl-6,6-dimethyl-2,5-dihydro-1H-pyridin-4-yl)-1-methyl-5-nitroindole (PubChem CID 122443269) has the molecular formula C20H27N3O2 and a molecular weight of 341.46 g/mol. Its IUPAC name is 3-(5-tert-butyl-6,6-dimethyl-2,5-dihydro-1H-pyridin-4-yl)-1-methyl-5-nitroindole.
| Compound Name | 3-(5-tert-butyl-6,6-dimethyl-2,5-dihydro-1H-pyridin-4-yl)-1-methyl-5-nitroindole |
|---|---|
| PubChem CID | 122443269 |
| Molecular Formula | C20H27N3O2 |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | 3-(5-tert-butyl-6,6-dimethyl-2,5-dihydro-1H-pyridin-4-yl)-1-methyl-5-nitroindole |
| SMILES | Cn1cc(C2=CCNC(C)(C)C2C(C)(C)C)c2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C20H27N3O2/c1-19(2,3)18-14(9-10-21-20(18,4)5)16-12-22(6)17-8-7-13(23(24)25)11-15(16)17/h7-9,11-12,18,21H,10H2,1-6H3 |
| InChIKey | SYUDVSGVESMKST-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 60.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|