C15H11F3N4O — CID 122443345
6-N-[5-(trifluoromethoxy)isoquinolin-1-yl]pyridine-2,6-diamine (PubChem CID 122443345) has the molecular formula C15H11F3N4O and a molecular weight of 320.27 g/mol. Its IUPAC name is 6-N-[5-(trifluoromethoxy)isoquinolin-1-yl]pyridine-2,6-diamine.
| Compound Name | 6-N-[5-(trifluoromethoxy)isoquinolin-1-yl]pyridine-2,6-diamine |
|---|---|
| PubChem CID | 122443345 |
| Molecular Formula | C15H11F3N4O |
| Molecular Weight | 320.27 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | 6-N-[5-(trifluoromethoxy)isoquinolin-1-yl]pyridine-2,6-diamine |
| SMILES | Nc1cccc(Nc2nccc3c(OC(F)(F)F)cccc23)n1 |
| InChI | InChI=1S/C15H11F3N4O/c16-15(17,18)23-11-4-1-3-10-9(11)7-8-20-14(10)22-13-6-2-5-12(19)21-13/h1-8H,(H3,19,20,21,22) |
| InChIKey | SLVCKDTVAMMPCL-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.27 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |