C15H21NO6 — CID 122455232
(1S)-1-[5-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-2-methylphenyl]-2-nitroethanol (PubChem CID 122455232) has the molecular formula C15H21NO6 and a molecular weight of 311.33 g/mol. Its IUPAC name is (1S)-1-[5-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-2-methylphenyl]-2-nitroethanol.
| Compound Name | (1S)-1-[5-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-2-methylphenyl]-2-nitroethanol |
|---|---|
| PubChem CID | 122455232 |
| Molecular Formula | C15H21NO6 |
| Molecular Weight | 311.33 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | (1S)-1-[5-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-2-methylphenyl]-2-nitroethanol |
| SMILES | Cc1ccc(OCC2COC(C)(C)O2)cc1[C@H](O)C[N+](=O)[O-] |
| InChI | InChI=1S/C15H21NO6/c1-10-4-5-11(6-13(10)14(17)7-16(18)19)20-8-12-9-21-15(2,3)22-12/h4-6,12,14,17H,7-9H2,1-3H3/t12?,14-/m1/s1 |
| InChIKey | FOFICZQJHBGKSF-TYZXPVIJSA-N |
| XLogP | 1.84 |
| TPSA | 91.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.33 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|