C12H14ClNO5 — CID 69450231
4-[(4-chloro-3-nitrophenoxy)methyl]-2,2-dimethyl-1,3-dioxolane (PubChem CID 69450231) has the molecular formula C12H14ClNO5 and a molecular weight of 287.70 g/mol. Its IUPAC name is 4-[(4-chloro-3-nitrophenoxy)methyl]-2,2-dimethyl-1,3-dioxolane.
| Compound Name | 4-[(4-chloro-3-nitrophenoxy)methyl]-2,2-dimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 69450231 |
| Molecular Formula | C12H14ClNO5 |
| Molecular Weight | 287.70 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | 4-[(4-chloro-3-nitrophenoxy)methyl]-2,2-dimethyl-1,3-dioxolane |
| SMILES | CC1(C)OCC(COc2ccc(Cl)c([N+](=O)[O-])c2)O1 |
| InChI | InChI=1S/C12H14ClNO5/c1-12(2)18-7-9(19-12)6-17-8-3-4-10(13)11(5-8)14(15)16/h3-5,9H,6-7H2,1-2H3 |
| InChIKey | XKKWBGSWWOACBD-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.70 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|