C15H18ClNO6 — CID 129097805
1-[5-chloro-2-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-4-methyl-3-nitrophenyl]ethanone (PubChem CID 129097805) has the molecular formula C15H18ClNO6 and a molecular weight of 343.76 g/mol. Its IUPAC name is 1-[5-chloro-2-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-4-methyl-3-nitrophenyl]ethanone.
| Compound Name | 1-[5-chloro-2-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-4-methyl-3-nitrophenyl]ethanone |
|---|---|
| PubChem CID | 129097805 |
| Molecular Formula | C15H18ClNO6 |
| Molecular Weight | 343.76 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | 1-[5-chloro-2-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-4-methyl-3-nitrophenyl]ethanone |
| SMILES | CC(=O)c1cc(Cl)c(C)c([N+](=O)[O-])c1OCC1COC(C)(C)O1 |
| InChI | InChI=1S/C15H18ClNO6/c1-8-12(16)5-11(9(2)18)14(13(8)17(19)20)21-6-10-7-22-15(3,4)23-10/h5,10H,6-7H2,1-4H3 |
| InChIKey | VGVQGVWFCNBXHM-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.76 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|