C18H10F3N5O2 — CID 122456085
2-[[6-[2-(trifluoromethyl)pyrimidin-5-yl]pyrimidin-4-yl]methyl]isoindole-1,3-dione (PubChem CID 122456085) has the molecular formula C18H10F3N5O2 and a molecular weight of 385.31 g/mol. Its IUPAC name is 2-[[6-[2-(trifluoromethyl)pyrimidin-5-yl]pyrimidin-4-yl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[6-[2-(trifluoromethyl)pyrimidin-5-yl]pyrimidin-4-yl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 122456085 |
| Molecular Formula | C18H10F3N5O2 |
| Molecular Weight | 385.31 g/mol |
| Exact Mass | 385.08 |
| IUPAC Name | 2-[[6-[2-(trifluoromethyl)pyrimidin-5-yl]pyrimidin-4-yl]methyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1Cc1cc(-c2cnc(C(F)(F)F)nc2)ncn1 |
| InChI | InChI=1S/C18H10F3N5O2/c19-18(20,21)17-22-6-10(7-23-17)14-5-11(24-9-25-14)8-26-15(27)12-3-1-2-4-13(12)16(26)28/h1-7,9H,8H2 |
| InChIKey | ZSCQCJGXLHDHPU-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 88.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.31 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|