C14H10BFN2O5 — CID 153410469
[2-[(1,3-dioxoisoindol-2-yl)methyl]-5-fluoro-4-pyridinyl]oxyboronic acid (PubChem CID 153410469) has the molecular formula C14H10BFN2O5 and a molecular weight of 316.05 g/mol. Its IUPAC name is [2-[(1,3-dioxoisoindol-2-yl)methyl]-5-fluoro-4-pyridinyl]oxyboronic acid.
| Compound Name | [2-[(1,3-dioxoisoindol-2-yl)methyl]-5-fluoro-4-pyridinyl]oxyboronic acid |
|---|---|
| PubChem CID | 153410469 |
| Molecular Formula | C14H10BFN2O5 |
| Molecular Weight | 316.05 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | [2-[(1,3-dioxoisoindol-2-yl)methyl]-5-fluoro-4-pyridinyl]oxyboronic acid |
| SMILES | O=C1c2ccccc2C(=O)N1Cc1cc(OB(O)O)c(F)cn1 |
| InChI | InChI=1S/C14H10BFN2O5/c16-11-6-17-8(5-12(11)23-15(21)22)7-18-13(19)9-3-1-2-4-10(9)14(18)20/h1-6,21-22H,7H2 |
| InChIKey | BCOMUVKSLWYVGL-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 99.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.05 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|