C22H17ClF3N3O2 — CID 144826339
2-[[5-chloro-4-[6-(trifluoromethyl)-3-pyridinyl]-2-pyridinyl]methyl]isoindole-1,3-dione;ethane (PubChem CID 144826339) has the molecular formula C22H17ClF3N3O2 and a molecular weight of 447.84 g/mol. Its IUPAC name is 2-[[5-chloro-4-[6-(trifluoromethyl)-3-pyridinyl]-2-pyridinyl]methyl]isoindole-1,3-dione;ethane.
| Compound Name | 2-[[5-chloro-4-[6-(trifluoromethyl)-3-pyridinyl]-2-pyridinyl]methyl]isoindole-1,3-dione;ethane |
|---|---|
| PubChem CID | 144826339 |
| Molecular Formula | C22H17ClF3N3O2 |
| Molecular Weight | 447.84 g/mol |
| Exact Mass | 447.10 |
| IUPAC Name | 2-[[5-chloro-4-[6-(trifluoromethyl)-3-pyridinyl]-2-pyridinyl]methyl]isoindole-1,3-dione;ethane |
| SMILES | CC.O=C1c2ccccc2C(=O)N1Cc1cc(-c2ccc(C(F)(F)F)nc2)c(Cl)cn1 |
| InChI | InChI=1S/C20H11ClF3N3O2.C2H6/c21-16-9-25-12(7-15(16)11-5-6-17(26-8-11)20(22,23)24)10-27-18(28)13-3-1-2-4-14(13)19(27)29;1-2/h1-9H,10H2;1-2H3 |
| InChIKey | MRVKLTJFKAAALD-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.84 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|