C18H11F3N4O2 — CID 142754074
2-[4-methyl-5-[6-(trifluoromethyl)-3-pyridinyl]-1H-pyrazol-3-yl]isoindole-1,3-dione (PubChem CID 142754074) has the molecular formula C18H11F3N4O2 and a molecular weight of 372.31 g/mol. Its IUPAC name is 2-[4-methyl-5-[6-(trifluoromethyl)-3-pyridinyl]-1H-pyrazol-3-yl]isoindole-1,3-dione.
| Compound Name | 2-[4-methyl-5-[6-(trifluoromethyl)-3-pyridinyl]-1H-pyrazol-3-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 142754074 |
| Molecular Formula | C18H11F3N4O2 |
| Molecular Weight | 372.31 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | 2-[4-methyl-5-[6-(trifluoromethyl)-3-pyridinyl]-1H-pyrazol-3-yl]isoindole-1,3-dione |
| SMILES | Cc1c(N2C(=O)c3ccccc3C2=O)n[nH]c1-c1ccc(C(F)(F)F)nc1 |
| InChI | InChI=1S/C18H11F3N4O2/c1-9-14(10-6-7-13(22-8-10)18(19,20)21)23-24-15(9)25-16(26)11-4-2-3-5-12(11)17(25)27/h2-8H,1H3,(H,23,24) |
| InChIKey | HYLOWKWOJFWEDJ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.31 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|