C16H20BrN3O2 — CID 122457667
(4-bromoisoquinolin-6-yl)methyl-[3-(dimethylamino)propyl]carbamic acid (PubChem CID 122457667) has the molecular formula C16H20BrN3O2 and a molecular weight of 366.26 g/mol. Its IUPAC name is (4-bromoisoquinolin-6-yl)methyl-[3-(dimethylamino)propyl]carbamic acid.
| Compound Name | (4-bromoisoquinolin-6-yl)methyl-[3-(dimethylamino)propyl]carbamic acid |
|---|---|
| PubChem CID | 122457667 |
| Molecular Formula | C16H20BrN3O2 |
| Molecular Weight | 366.26 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | (4-bromoisoquinolin-6-yl)methyl-[3-(dimethylamino)propyl]carbamic acid |
| SMILES | CN(C)CCCN(Cc1ccc2cncc(Br)c2c1)C(=O)O |
| InChI | InChI=1S/C16H20BrN3O2/c1-19(2)6-3-7-20(16(21)22)11-12-4-5-13-9-18-10-15(17)14(13)8-12/h4-5,8-10H,3,6-7,11H2,1-2H3,(H,21,22) |
| InChIKey | GAZKCMFVWHSYSZ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 56.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.26 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |