C38H49Br3N2O6 — CID 159245602
4-bromo-6-(bromomethyl)isoquinoline;tert-butyl 5-[(4-bromoisoquinolin-6-yl)methoxy]pentanoate;tert-butyl 5-hydroxypentanoate (PubChem CID 159245602) has the molecular formula C38H49Br3N2O6 and a molecular weight of 869.53 g/mol. Its IUPAC name is 4-bromo-6-(bromomethyl)isoquinoline;tert-butyl 5-[(4-bromoisoquinolin-6-yl)methoxy]pentanoate;tert-butyl 5-hydroxypentanoate.
| Compound Name | 4-bromo-6-(bromomethyl)isoquinoline;tert-butyl 5-[(4-bromoisoquinolin-6-yl)methoxy]pentanoate;tert-butyl 5-hydroxypentanoate |
|---|---|
| PubChem CID | 159245602 |
| Molecular Formula | C38H49Br3N2O6 |
| Molecular Weight | 869.53 g/mol |
| Exact Mass | 866.11 |
| IUPAC Name | 4-bromo-6-(bromomethyl)isoquinoline;tert-butyl 5-[(4-bromoisoquinolin-6-yl)methoxy]pentanoate;tert-butyl 5-hydroxypentanoate |
| SMILES | BrCc1ccc2cncc(Br)c2c1.CC(C)(C)OC(=O)CCCCO.CC(C)(C)OC(=O)CCCCOCc1ccc2cncc(Br)c2c1 |
| InChI | InChI=1S/C19H24BrNO3.C10H7Br2N.C9H18O3/c1-19(2,3)24-18(22)6-4-5-9-23-13-14-7-8-15-11-21-12-17(20)16(15)10-14;11-4-7-1-2-8-5-13-6-10(12)9(8)3-7;1-9(2,3)12-8(11)6-4-5-7-10/h7-8,10-12H,4-6,9,13H2,1-3H3;1-3,5-6H,4H2;10H,4-7H2,1-3H3 |
| InChIKey | KUQKCDCZEITTTA-UHFFFAOYSA-N |
| XLogP | 10.41 |
| TPSA | 107.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 869.53 |
| LogP ≤ 5 | 10.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|