C19H26BrN3O2 — CID 122457865
tert-butyl N-[4-[(4-bromoisoquinolin-6-yl)methylamino]butyl]carbamate (PubChem CID 122457865) has the molecular formula C19H26BrN3O2 and a molecular weight of 408.34 g/mol. Its IUPAC name is tert-butyl N-[4-[(4-bromoisoquinolin-6-yl)methylamino]butyl]carbamate.
| Compound Name | tert-butyl N-[4-[(4-bromoisoquinolin-6-yl)methylamino]butyl]carbamate |
|---|---|
| PubChem CID | 122457865 |
| Molecular Formula | C19H26BrN3O2 |
| Molecular Weight | 408.34 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | tert-butyl N-[4-[(4-bromoisoquinolin-6-yl)methylamino]butyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCNCc1ccc2cncc(Br)c2c1 |
| InChI | InChI=1S/C19H26BrN3O2/c1-19(2,3)25-18(24)23-9-5-4-8-21-11-14-6-7-15-12-22-13-17(20)16(15)10-14/h6-7,10,12-13,21H,4-5,8-9,11H2,1-3H3,(H,23,24) |
| InChIKey | YODIFNHMKWVQGA-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.34 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|