C16H17BrClN3O2 — CID 122457685
[1-[(4-bromo-8-chloroisoquinolin-6-yl)methyl]piperidin-4-yl]carbamic acid (PubChem CID 122457685) has the molecular formula C16H17BrClN3O2 and a molecular weight of 398.69 g/mol. Its IUPAC name is [1-[(4-bromo-8-chloroisoquinolin-6-yl)methyl]piperidin-4-yl]carbamic acid.
| Compound Name | [1-[(4-bromo-8-chloroisoquinolin-6-yl)methyl]piperidin-4-yl]carbamic acid |
|---|---|
| PubChem CID | 122457685 |
| Molecular Formula | C16H17BrClN3O2 |
| Molecular Weight | 398.69 g/mol |
| Exact Mass | 397.02 |
| IUPAC Name | [1-[(4-bromo-8-chloroisoquinolin-6-yl)methyl]piperidin-4-yl]carbamic acid |
| SMILES | O=C(O)NC1CCN(Cc2cc(Cl)c3cncc(Br)c3c2)CC1 |
| InChI | InChI=1S/C16H17BrClN3O2/c17-14-8-19-7-13-12(14)5-10(6-15(13)18)9-21-3-1-11(2-4-21)20-16(22)23/h5-8,11,20H,1-4,9H2,(H,22,23) |
| InChIKey | OHYAKSSAEWUVKJ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.69 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |