C22H21NO4S — CID 122463848
[4-[(Z)-1-(4-aminophenyl)-2-phenylbut-1-enyl]phenyl] hydrogen sulfate (PubChem CID 122463848) has the molecular formula C22H21NO4S and a molecular weight of 395.48 g/mol. Its IUPAC name is [4-[(Z)-1-(4-aminophenyl)-2-phenylbut-1-enyl]phenyl] hydrogen sulfate.
| Compound Name | [4-[(Z)-1-(4-aminophenyl)-2-phenylbut-1-enyl]phenyl] hydrogen sulfate |
|---|---|
| PubChem CID | 122463848 |
| Molecular Formula | C22H21NO4S |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | [4-[(Z)-1-(4-aminophenyl)-2-phenylbut-1-enyl]phenyl] hydrogen sulfate |
| SMILES | CC/C(=C(\c1ccc(N)cc1)c1ccc(OS(=O)(=O)O)cc1)c1ccccc1 |
| InChI | InChI=1S/C22H21NO4S/c1-2-21(16-6-4-3-5-7-16)22(17-8-12-19(23)13-9-17)18-10-14-20(15-11-18)27-28(24,25)26/h3-15H,2,23H2,1H3,(H,24,25,26)/b22-21- |
| InChIKey | VOKOJQOUKLDHSU-DQRAZIAOSA-N |
| XLogP | 4.82 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|