C17H10F6O2 — CID 122476274
5-[(E)-2-[3,5-bis(trifluoromethyl)phenyl]ethenyl]-2-hydroxybenzaldehyde (PubChem CID 122476274) has the molecular formula C17H10F6O2 and a molecular weight of 360.25 g/mol. Its IUPAC name is 5-[(E)-2-[3,5-bis(trifluoromethyl)phenyl]ethenyl]-2-hydroxybenzaldehyde.
| Compound Name | 5-[(E)-2-[3,5-bis(trifluoromethyl)phenyl]ethenyl]-2-hydroxybenzaldehyde |
|---|---|
| PubChem CID | 122476274 |
| Molecular Formula | C17H10F6O2 |
| Molecular Weight | 360.25 g/mol |
| Exact Mass | 360.06 |
| IUPAC Name | 5-[(E)-2-[3,5-bis(trifluoromethyl)phenyl]ethenyl]-2-hydroxybenzaldehyde |
| SMILES | O=Cc1cc(/C=C/c2cc(C(F)(F)F)cc(C(F)(F)F)c2)ccc1O |
| InChI | InChI=1S/C17H10F6O2/c18-16(19,20)13-6-11(7-14(8-13)17(21,22)23)2-1-10-3-4-15(25)12(5-10)9-24/h1-9,25H/b2-1+ |
| InChIKey | BFLYHGXCZHJOPU-OWOJBTEDSA-N |
| XLogP | 5.41 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.25 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|