C21H16F6 — CID 144776674
acetylene;1-[(E)-2-(3-ethenyl-4-methylphenyl)ethenyl]-3,5-bis(trifluoromethyl)benzene (PubChem CID 144776674) has the molecular formula C21H16F6 and a molecular weight of 382.35 g/mol. Its IUPAC name is acetylene;1-[(E)-2-(3-ethenyl-4-methylphenyl)ethenyl]-3,5-bis(trifluoromethyl)benzene.
| Compound Name | acetylene;1-[(E)-2-(3-ethenyl-4-methylphenyl)ethenyl]-3,5-bis(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 144776674 |
| Molecular Formula | C21H16F6 |
| Molecular Weight | 382.35 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | acetylene;1-[(E)-2-(3-ethenyl-4-methylphenyl)ethenyl]-3,5-bis(trifluoromethyl)benzene |
| SMILES | C#C.C=Cc1cc(/C=C/c2cc(C(F)(F)F)cc(C(F)(F)F)c2)ccc1C |
| InChI | InChI=1S/C19H14F6.C2H2/c1-3-15-8-13(5-4-12(15)2)6-7-14-9-16(18(20,21)22)11-17(10-14)19(23,24)25;1-2/h3-11H,1H2,2H3;1-2H/b7-6+; |
| InChIKey | ALQVMJHQBXPITL-UHDJGPCESA-N |
| XLogP | 7.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.35 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|