About 5-[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-3-fluorophenyl]-2H-triazole-4-carbonitrile
5-[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-3-fluorophenyl]-2H-triazole-4-carbonitrile (PubChem CID 122477572) has the molecular formula C18H9F7N4O
and a molecular weight of 430.28 g/mol. Its IUPAC name is 5-[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-3-fluorophenyl]-2H-triazole-4-carbonitrile.
Molecular Properties
| Compound Name | 5-[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-3-fluorophenyl]-2H-triazole-4-carbonitrile |
| PubChem CID | 122477572 |
| Molecular Formula | C18H9F7N4O |
| Molecular Weight | 430.28 g/mol |
| Exact Mass | 430.07 |
| IUPAC Name | 5-[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-3-fluorophenyl]-2H-triazole-4-carbonitrile |
| SMILES | N#Cc1n[nH]nc1-c1cccc(F)c1OCc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H9F7N4O/c19-13-3-1-2-12(15-14(7-26)27-29-28-15)16(13)30-8-9-4-10(17(20,21)22)6-11(5-9)18(23,24)25/h1-6H,8H2,(H,27,28,29) |
| InChIKey | DCQXQKQHIRAAPK-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 74.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 430.28 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-3-fluorophenyl]-2H-triazole-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-3-fluorophenyl]-2H-triazole-4-carbonitrile?
The IUPAC name of 5-[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-3-fluorophenyl]-2H-triazole-4-carbonitrile (CID 122477572) is 5-[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-3-fluorophenyl]-2H-triazole-4-carbonitrile.
What is the SMILES notation for 5-[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-3-fluorophenyl]-2H-triazole-4-carbonitrile?
The canonical SMILES for 5-[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-3-fluorophenyl]-2H-triazole-4-carbonitrile is N#Cc1n[nH]nc1-c1cccc(F)c1OCc1cc(C(F)(F)F)cc(C(F)(F)F)c1.
What is the InChIKey of 5-[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-3-fluorophenyl]-2H-triazole-4-carbonitrile?
The InChIKey is DCQXQKQHIRAAPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H9F7N4O/c19-13-3-1-2-12(15-14(7-26)27-29-28-15)16(13)30-8-9-4-10(17(20,21)22)6-11(5-9)18(23,24)25/h1-6H,8H2,(H,27,28,29).
What are the key properties of 5-[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-3-fluorophenyl]-2H-triazole-4-carbonitrile?
5-[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-3-fluorophenyl]-2H-triazole-4-carbonitrile has a molecular weight of 430.28 g/mol, XLogP of 5.10, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-3-fluorophenyl]-2H-triazole-4-carbonitrile is sourced from PubChem (CID 122477572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).