C26H22F2N2O2 — CID 175756019
2-[[3-tert-butyl-5-[(2-cyano-6-fluorophenoxy)methyl]phenyl]methoxy]-3-fluorobenzonitrile (PubChem CID 175756019) has the molecular formula C26H22F2N2O2 and a molecular weight of 432.47 g/mol. Its IUPAC name is 2-[[3-tert-butyl-5-[(2-cyano-6-fluorophenoxy)methyl]phenyl]methoxy]-3-fluorobenzonitrile.
| Compound Name | 2-[[3-tert-butyl-5-[(2-cyano-6-fluorophenoxy)methyl]phenyl]methoxy]-3-fluorobenzonitrile |
|---|---|
| PubChem CID | 175756019 |
| Molecular Formula | C26H22F2N2O2 |
| Molecular Weight | 432.47 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | 2-[[3-tert-butyl-5-[(2-cyano-6-fluorophenoxy)methyl]phenyl]methoxy]-3-fluorobenzonitrile |
| SMILES | CC(C)(C)c1cc(COc2c(F)cccc2C#N)cc(COc2c(F)cccc2C#N)c1 |
| InChI | InChI=1S/C26H22F2N2O2/c1-26(2,3)21-11-17(15-31-24-19(13-29)6-4-8-22(24)27)10-18(12-21)16-32-25-20(14-30)7-5-9-23(25)28/h4-12H,15-16H2,1-3H3 |
| InChIKey | UNFKJHFTXCRSDI-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 66.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.47 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |