C15H9F4NO — CID 143183138
2-(1,1-difluoroethyl)-4-(2,6-difluorophenoxy)benzonitrile (PubChem CID 143183138) has the molecular formula C15H9F4NO and a molecular weight of 295.24 g/mol. Its IUPAC name is 2-(1,1-difluoroethyl)-4-(2,6-difluorophenoxy)benzonitrile.
| Compound Name | 2-(1,1-difluoroethyl)-4-(2,6-difluorophenoxy)benzonitrile |
|---|---|
| PubChem CID | 143183138 |
| Molecular Formula | C15H9F4NO |
| Molecular Weight | 295.24 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | 2-(1,1-difluoroethyl)-4-(2,6-difluorophenoxy)benzonitrile |
| SMILES | CC(F)(F)c1cc(Oc2c(F)cccc2F)ccc1C#N |
| InChI | InChI=1S/C15H9F4NO/c1-15(18,19)11-7-10(6-5-9(11)8-20)21-14-12(16)3-2-4-13(14)17/h2-7H,1H3 |
| InChIKey | DTXQXTKPUQODID-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.24 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |