C16H22S — CID 122491934
(3Z,5Z)-1-(2,3-dimethylphenyl)-2-methylhepta-3,5-diene-3-thiol (PubChem CID 122491934) has the molecular formula C16H22S and a molecular weight of 246.42 g/mol. Its IUPAC name is (3Z,5Z)-1-(2,3-dimethylphenyl)-2-methylhepta-3,5-diene-3-thiol.
| Compound Name | (3Z,5Z)-1-(2,3-dimethylphenyl)-2-methylhepta-3,5-diene-3-thiol |
|---|---|
| PubChem CID | 122491934 |
| Molecular Formula | C16H22S |
| Molecular Weight | 246.42 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | (3Z,5Z)-1-(2,3-dimethylphenyl)-2-methylhepta-3,5-diene-3-thiol |
| SMILES | C/C=C\C=C(/S)C(C)Cc1cccc(C)c1C |
| InChI | InChI=1S/C16H22S/c1-5-6-10-16(17)13(3)11-15-9-7-8-12(2)14(15)4/h5-10,13,17H,11H2,1-4H3/b6-5-,16-10- |
| InChIKey | RGWJPTGHOAZWKH-PEALFLFQSA-N |
| XLogP | 4.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.42 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|