C15H15NO — CID 122491961
3-ethyl-5,6-dihydro-[1]benzoxepino[2,3-c]pyridine (PubChem CID 122491961) has the molecular formula C15H15NO and a molecular weight of 225.29 g/mol. Its IUPAC name is 3-ethyl-5,6-dihydro-[1]benzoxepino[2,3-c]pyridine.
| Compound Name | 3-ethyl-5,6-dihydro-[1]benzoxepino[2,3-c]pyridine |
|---|---|
| PubChem CID | 122491961 |
| Molecular Formula | C15H15NO |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | 3-ethyl-5,6-dihydro-[1]benzoxepino[2,3-c]pyridine |
| SMILES | CCc1cc2c(cn1)Oc1ccccc1CC2 |
| InChI | InChI=1S/C15H15NO/c1-2-13-9-12-8-7-11-5-3-4-6-14(11)17-15(12)10-16-13/h3-6,9-10H,2,7-8H2,1H3 |
| InChIKey | DCPODVYHMABBBF-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |