C11H12O — CID 145341121
(2E)-2-ethylidene-3,4-dihydrochromene (PubChem CID 145341121) has the molecular formula C11H12O and a molecular weight of 160.22 g/mol. Its IUPAC name is (2E)-2-ethylidene-3,4-dihydrochromene.
| Compound Name | (2E)-2-ethylidene-3,4-dihydrochromene |
|---|---|
| PubChem CID | 145341121 |
| Molecular Formula | C11H12O |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.09 |
| IUPAC Name | (2E)-2-ethylidene-3,4-dihydrochromene |
| SMILES | C/C=C1\CCc2ccccc2O1 |
| InChI | InChI=1S/C11H12O/c1-2-10-8-7-9-5-3-4-6-11(9)12-10/h2-6H,7-8H2,1H3/b10-2+ |
| InChIKey | CEMXPFZWRIUCSH-WTDSWWLTSA-N |
| XLogP | 2.92 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |