About 2-tert-butyl-5,6-dihydro-[1]benzoxepino[3,2-b]pyridine
2-tert-butyl-5,6-dihydro-[1]benzoxepino[3,2-b]pyridine (PubChem CID 134215019) has the molecular formula C17H19NO
and a molecular weight of 253.34 g/mol. Its IUPAC name is 2-tert-butyl-5,6-dihydro-[1]benzoxepino[3,2-b]pyridine.
Molecular Properties
| Compound Name | 2-tert-butyl-5,6-dihydro-[1]benzoxepino[3,2-b]pyridine |
| PubChem CID | 134215019 |
| Molecular Formula | C17H19NO |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | 2-tert-butyl-5,6-dihydro-[1]benzoxepino[3,2-b]pyridine |
| SMILES | CC(C)(C)c1cnc2c(c1)Oc1ccccc1CC2 |
| InChI | InChI=1S/C17H19NO/c1-17(2,3)13-10-16-14(18-11-13)9-8-12-6-4-5-7-15(12)19-16/h4-7,10-11H,8-9H2,1-3H3 |
| InChIKey | IONCLVBOWAUNDV-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-tert-butyl-5,6-dihydro-[1]benzoxepino[3,2-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-5,6-dihydro-[1]benzoxepino[3,2-b]pyridine?
The IUPAC name of 2-tert-butyl-5,6-dihydro-[1]benzoxepino[3,2-b]pyridine (CID 134215019) is 2-tert-butyl-5,6-dihydro-[1]benzoxepino[3,2-b]pyridine.
What is the SMILES notation for 2-tert-butyl-5,6-dihydro-[1]benzoxepino[3,2-b]pyridine?
The canonical SMILES for 2-tert-butyl-5,6-dihydro-[1]benzoxepino[3,2-b]pyridine is CC(C)(C)c1cnc2c(c1)Oc1ccccc1CC2.
What is the InChIKey of 2-tert-butyl-5,6-dihydro-[1]benzoxepino[3,2-b]pyridine?
The InChIKey is IONCLVBOWAUNDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19NO/c1-17(2,3)13-10-16-14(18-11-13)9-8-12-6-4-5-7-15(12)19-16/h4-7,10-11H,8-9H2,1-3H3.
What are the key properties of 2-tert-butyl-5,6-dihydro-[1]benzoxepino[3,2-b]pyridine?
2-tert-butyl-5,6-dihydro-[1]benzoxepino[3,2-b]pyridine has a molecular weight of 253.34 g/mol, XLogP of 4.27, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-5,6-dihydro-[1]benzoxepino[3,2-b]pyridine is sourced from PubChem (CID 134215019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).