C17H19NO — CID 134215019
2-tert-butyl-5,6-dihydro-[1]benzoxepino[3,2-b]pyridine (PubChem CID 134215019) has the molecular formula C17H19NO and a molecular weight of 253.34 g/mol. Its IUPAC name is 2-tert-butyl-5,6-dihydro-[1]benzoxepino[3,2-b]pyridine.
| Compound Name | 2-tert-butyl-5,6-dihydro-[1]benzoxepino[3,2-b]pyridine |
|---|---|
| PubChem CID | 134215019 |
| Molecular Formula | C17H19NO |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | 2-tert-butyl-5,6-dihydro-[1]benzoxepino[3,2-b]pyridine |
| SMILES | CC(C)(C)c1cnc2c(c1)Oc1ccccc1CC2 |
| InChI | InChI=1S/C17H19NO/c1-17(2,3)13-10-16-14(18-11-13)9-8-12-6-4-5-7-15(12)19-16/h4-7,10-11H,8-9H2,1-3H3 |
| InChIKey | IONCLVBOWAUNDV-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |