C10H16N2O12P2 — CID 122496719
[(2R,3R,4R,5S)-5-(2,4-dioxo-1H-pyrimidin-6-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methyl phosphono hydrogen phosphate (PubChem CID 122496719) has the molecular formula C10H16N2O12P2 and a molecular weight of 418.19 g/mol. Its IUPAC name is [(2R,3R,4R,5S)-5-(2,4-dioxo-1H-pyrimidin-6-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methyl phosphono hydrogen phosphate.
| Compound Name | [(2R,3R,4R,5S)-5-(2,4-dioxo-1H-pyrimidin-6-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methyl phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 122496719 |
| Molecular Formula | C10H16N2O12P2 |
| Molecular Weight | 418.19 g/mol |
| Exact Mass | 418.02 |
| IUPAC Name | [(2R,3R,4R,5S)-5-(2,4-dioxo-1H-pyrimidin-6-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methyl phosphono hydrogen phosphate |
| SMILES | C[C@@]1(O)[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O)O)O[C@H]1c1cc(=O)[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C10H16N2O12P2/c1-10(16)7(14)5(3-22-26(20,21)24-25(17,18)19)23-8(10)4-2-6(13)12-9(15)11-4/h2,5,7-8,14,16H,3H2,1H3,(H,20,21)(H2,17,18,19)(H2,11,12,13,15)/t5-,7-,8+,10-/m1/s1 |
| InChIKey | NQUDCWGUDZMBPK-PJGXCUNHSA-N |
| XLogP | -2.16 |
| TPSA | 228.70 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.19 |
| LogP ≤ 5 | -2.16 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|