C20H22IN3O8 — CID 122500428
(2R)-2-[[(4S)-4-carboxy-4-[[4-[iodo(prop-2-ynyl)amino]benzoyl]amino]butanoyl]amino]pentanedioic acid (PubChem CID 122500428) has the molecular formula C20H22IN3O8 and a molecular weight of 559.31 g/mol. Its IUPAC name is (2R)-2-[[(4S)-4-carboxy-4-[[4-[iodo(prop-2-ynyl)amino]benzoyl]amino]butanoyl]amino]pentanedioic acid.
| Compound Name | (2R)-2-[[(4S)-4-carboxy-4-[[4-[iodo(prop-2-ynyl)amino]benzoyl]amino]butanoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 122500428 |
| Molecular Formula | C20H22IN3O8 |
| Molecular Weight | 559.31 g/mol |
| Exact Mass | 559.05 |
| IUPAC Name | (2R)-2-[[(4S)-4-carboxy-4-[[4-[iodo(prop-2-ynyl)amino]benzoyl]amino]butanoyl]amino]pentanedioic acid |
| SMILES | C#CCN(I)c1ccc(C(=O)N[C@@H](CCC(=O)N[C@H](CCC(=O)O)C(=O)O)C(=O)O)cc1 |
| InChI | InChI=1S/C20H22IN3O8/c1-2-11-24(21)13-5-3-12(4-6-13)18(28)23-15(20(31)32)7-9-16(25)22-14(19(29)30)8-10-17(26)27/h1,3-6,14-15H,7-11H2,(H,22,25)(H,23,28)(H,26,27)(H,29,30)(H,31,32)/t14-,15+/m1/s1 |
| InChIKey | LMBMLKOUCWBYQV-CABCVRRESA-N |
| XLogP | 0.87 |
| TPSA | 173.34 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.31 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|