C20H23N3O8 — CID 88560902
(2R)-2-[[(4S)-4-carboxy-4-[[4-(prop-2-ynylamino)benzoyl]amino]butanoyl]amino]pentanedioic acid (PubChem CID 88560902) has the molecular formula C20H23N3O8 and a molecular weight of 433.42 g/mol. Its IUPAC name is (2R)-2-[[(4S)-4-carboxy-4-[[4-(prop-2-ynylamino)benzoyl]amino]butanoyl]amino]pentanedioic acid.
| Compound Name | (2R)-2-[[(4S)-4-carboxy-4-[[4-(prop-2-ynylamino)benzoyl]amino]butanoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 88560902 |
| Molecular Formula | C20H23N3O8 |
| Molecular Weight | 433.42 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | (2R)-2-[[(4S)-4-carboxy-4-[[4-(prop-2-ynylamino)benzoyl]amino]butanoyl]amino]pentanedioic acid |
| SMILES | C#CCNc1ccc(C(=O)N[C@@H](CCC(=O)N[C@H](CCC(=O)O)C(=O)O)C(=O)O)cc1 |
| InChI | InChI=1S/C20H23N3O8/c1-2-11-21-13-5-3-12(4-6-13)18(27)23-15(20(30)31)7-9-16(24)22-14(19(28)29)8-10-17(25)26/h1,3-6,14-15,21H,7-11H2,(H,22,24)(H,23,27)(H,25,26)(H,28,29)(H,30,31)/t14-,15+/m1/s1 |
| InChIKey | YNHXVVWVCCOKJF-CABCVRRESA-N |
| XLogP | 0.13 |
| TPSA | 182.13 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.42 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|