C16H24O2 — CID 122503618
2-[(3-tert-butyl-4-methoxy-5-methylphenyl)methyl]prop-2-en-1-ol (PubChem CID 122503618) has the molecular formula C16H24O2 and a molecular weight of 248.37 g/mol. Its IUPAC name is 2-[(3-tert-butyl-4-methoxy-5-methylphenyl)methyl]prop-2-en-1-ol.
| Compound Name | 2-[(3-tert-butyl-4-methoxy-5-methylphenyl)methyl]prop-2-en-1-ol |
|---|---|
| PubChem CID | 122503618 |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | 2-[(3-tert-butyl-4-methoxy-5-methylphenyl)methyl]prop-2-en-1-ol |
| SMILES | C=C(CO)Cc1cc(C)c(OC)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C16H24O2/c1-11(10-17)7-13-8-12(2)15(18-6)14(9-13)16(3,4)5/h8-9,17H,1,7,10H2,2-6H3 |
| InChIKey | OVNZRDQOZYOHKU-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|