C19H26O6 — CID 122504229
(1S,12R,13S)-13-hydroxy-6-(1-hydroxypropan-2-yl)-1,12-dimethyl-5,10-dioxatetracyclo[7.6.1.02,7.012,16]hexadec-2-ene-4,11-dione (PubChem CID 122504229) has the molecular formula C19H26O6 and a molecular weight of 350.41 g/mol. Its IUPAC name is (1S,12R,13S)-13-hydroxy-6-(1-hydroxypropan-2-yl)-1,12-dimethyl-5,10-dioxatetracyclo[7.6.1.02,7.012,16]hexadec-2-ene-4,11-dione.
| Compound Name | (1S,12R,13S)-13-hydroxy-6-(1-hydroxypropan-2-yl)-1,12-dimethyl-5,10-dioxatetracyclo[7.6.1.02,7.012,16]hexadec-2-ene-4,11-dione |
|---|---|
| PubChem CID | 122504229 |
| Molecular Formula | C19H26O6 |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | (1S,12R,13S)-13-hydroxy-6-(1-hydroxypropan-2-yl)-1,12-dimethyl-5,10-dioxatetracyclo[7.6.1.02,7.012,16]hexadec-2-ene-4,11-dione |
| SMILES | CC(CO)C1OC(=O)C=C2C1CC1OC(=O)[C@]3(C)C1[C@]2(C)CC[C@@H]3O |
| InChI | InChI=1S/C19H26O6/c1-9(8-20)15-10-6-12-16-18(2,11(10)7-14(22)25-15)5-4-13(21)19(16,3)17(23)24-12/h7,9-10,12-13,15-16,20-21H,4-6,8H2,1-3H3/t9?,10?,12?,13-,15?,16?,18+,19-/m0/s1 |
| InChIKey | KQDWJETYFRFJQR-QNWUFPNPSA-N |
| XLogP | 1.20 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |