C23H23NO6 — CID 122506795
6-ethyl-16,17-dimethoxy-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(21),2,4(8),9,15(20),16,18-heptaene-21-carboxylic acid (PubChem CID 122506795) has the molecular formula C23H23NO6 and a molecular weight of 409.44 g/mol. Its IUPAC name is 6-ethyl-16,17-dimethoxy-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(21),2,4(8),9,15(20),16,18-heptaene-21-carboxylic acid.
| Compound Name | 6-ethyl-16,17-dimethoxy-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(21),2,4(8),9,15(20),16,18-heptaene-21-carboxylic acid |
|---|---|
| PubChem CID | 122506795 |
| Molecular Formula | C23H23NO6 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | 6-ethyl-16,17-dimethoxy-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(21),2,4(8),9,15(20),16,18-heptaene-21-carboxylic acid |
| SMILES | CCC1Oc2cc3c(cc2O1)C1=C(C(=O)O)c2ccc(OC)c(OC)c2CN1CC3 |
| InChI | InChI=1S/C23H23NO6/c1-4-19-29-17-9-12-7-8-24-11-15-13(5-6-16(27-2)22(15)28-3)20(23(25)26)21(24)14(12)10-18(17)30-19/h5-6,9-10,19H,4,7-8,11H2,1-3H3,(H,25,26) |
| InChIKey | BZOQORXLPUTZLX-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|