C24H25N7O6S — CID 122507635
tert-butyl 5-[(2-methylpropan-2-yl)oxycarbonyl-[5-(5-nitro-3-pyridinyl)-1,3,4-thiadiazol-2-yl]amino]indazole-1-carboxylate (PubChem CID 122507635) has the molecular formula C24H25N7O6S and a molecular weight of 539.57 g/mol. Its IUPAC name is tert-butyl 5-[(2-methylpropan-2-yl)oxycarbonyl-[5-(5-nitro-3-pyridinyl)-1,3,4-thiadiazol-2-yl]amino]indazole-1-carboxylate.
| Compound Name | tert-butyl 5-[(2-methylpropan-2-yl)oxycarbonyl-[5-(5-nitro-3-pyridinyl)-1,3,4-thiadiazol-2-yl]amino]indazole-1-carboxylate |
|---|---|
| PubChem CID | 122507635 |
| Molecular Formula | C24H25N7O6S |
| Molecular Weight | 539.57 g/mol |
| Exact Mass | 539.16 |
| IUPAC Name | tert-butyl 5-[(2-methylpropan-2-yl)oxycarbonyl-[5-(5-nitro-3-pyridinyl)-1,3,4-thiadiazol-2-yl]amino]indazole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N(c1ccc2c(cnn2C(=O)OC(C)(C)C)c1)c1nnc(-c2cncc([N+](=O)[O-])c2)s1 |
| InChI | InChI=1S/C24H25N7O6S/c1-23(2,3)36-21(32)29(20-28-27-19(38-20)15-10-17(31(34)35)13-25-11-15)16-7-8-18-14(9-16)12-26-30(18)22(33)37-24(4,5)6/h7-13H,1-6H3 |
| InChIKey | KEFPEAIBZQSKEE-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 155.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.57 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|