C22H21NO2 — CID 1225094
(2R)-1-(2,3-dihydroindol-1-yl)-2-naphthalen-2-yloxybutan-1-one (PubChem CID 1225094) has the molecular formula C22H21NO2 and a molecular weight of 331.42 g/mol. Its IUPAC name is (2R)-1-(2,3-dihydroindol-1-yl)-2-naphthalen-2-yloxybutan-1-one.
| Compound Name | (2R)-1-(2,3-dihydroindol-1-yl)-2-naphthalen-2-yloxybutan-1-one |
|---|---|
| PubChem CID | 1225094 |
| Molecular Formula | C22H21NO2 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | (2R)-1-(2,3-dihydroindol-1-yl)-2-naphthalen-2-yloxybutan-1-one |
| SMILES | CC[C@@H](Oc1ccc2ccccc2c1)C(=O)N1CCc2ccccc21 |
| InChI | InChI=1S/C22H21NO2/c1-2-21(22(24)23-14-13-17-8-5-6-10-20(17)23)25-19-12-11-16-7-3-4-9-18(16)15-19/h3-12,15,21H,2,13-14H2,1H3/t21-/m1/s1 |
| InChIKey | KBWYGSSECXLYSO-OAQYLSRUSA-N |
| XLogP | 4.59 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |