C23H19N5 — CID 122510644
N-benzyl-6-(5-phenyl-1H-imidazol-4-yl)-1H-benzimidazol-2-amine (PubChem CID 122510644) has the molecular formula C23H19N5 and a molecular weight of 365.44 g/mol. Its IUPAC name is N-benzyl-6-(5-phenyl-1H-imidazol-4-yl)-1H-benzimidazol-2-amine.
| Compound Name | N-benzyl-6-(5-phenyl-1H-imidazol-4-yl)-1H-benzimidazol-2-amine |
|---|---|
| PubChem CID | 122510644 |
| Molecular Formula | C23H19N5 |
| Molecular Weight | 365.44 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | N-benzyl-6-(5-phenyl-1H-imidazol-4-yl)-1H-benzimidazol-2-amine |
| SMILES | c1ccc(CNc2nc3ccc(-c4nc[nH]c4-c4ccccc4)cc3[nH]2)cc1 |
| InChI | InChI=1S/C23H19N5/c1-3-7-16(8-4-1)14-24-23-27-19-12-11-18(13-20(19)28-23)22-21(25-15-26-22)17-9-5-2-6-10-17/h1-13,15H,14H2,(H,25,26)(H2,24,27,28) |
| InChIKey | XAIRJJRQUDLDMP-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.44 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |