C18H23N3O4 — CID 122513967
2-[2-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]-2,6-diazaspiro[4.5]decane-6-carboxylic acid (PubChem CID 122513967) has the molecular formula C18H23N3O4 and a molecular weight of 345.40 g/mol. Its IUPAC name is 2-[2-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]-2,6-diazaspiro[4.5]decane-6-carboxylic acid.
| Compound Name | 2-[2-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]-2,6-diazaspiro[4.5]decane-6-carboxylic acid |
|---|---|
| PubChem CID | 122513967 |
| Molecular Formula | C18H23N3O4 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | 2-[2-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]-2,6-diazaspiro[4.5]decane-6-carboxylic acid |
| SMILES | O=C(/C=C/c1ccccc1N1CCC2(CCCCN2C(=O)O)C1)NO |
| InChI | InChI=1S/C18H23N3O4/c22-16(19-25)8-7-14-5-1-2-6-15(14)20-12-10-18(13-20)9-3-4-11-21(18)17(23)24/h1-2,5-8,25H,3-4,9-13H2,(H,19,22)(H,23,24)/b8-7+ |
| InChIKey | QCNIONSSZKBIHY-BQYQJAHWSA-N |
| XLogP | 2.32 |
| TPSA | 93.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|