C22H20O3 — CID 122530240
[3-(2,3-diphenylcycloprop-2-en-1-yl)-3-oxopropyl] 2-methylprop-2-enoate (PubChem CID 122530240) has the molecular formula C22H20O3 and a molecular weight of 332.40 g/mol. Its IUPAC name is [3-(2,3-diphenylcycloprop-2-en-1-yl)-3-oxopropyl] 2-methylprop-2-enoate.
| Compound Name | [3-(2,3-diphenylcycloprop-2-en-1-yl)-3-oxopropyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 122530240 |
| Molecular Formula | C22H20O3 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | [3-(2,3-diphenylcycloprop-2-en-1-yl)-3-oxopropyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC(=O)C1C(c2ccccc2)=C1c1ccccc1 |
| InChI | InChI=1S/C22H20O3/c1-15(2)22(24)25-14-13-18(23)21-19(16-9-5-3-6-10-16)20(21)17-11-7-4-8-12-17/h3-12,21H,1,13-14H2,2H3 |
| InChIKey | XIUYKVQODJKDBT-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|