C22H29N3O3 — CID 122530718
[1-amino-3-[[4-phenyl-2-(2-phenylethyl)butanoyl]amino]propan-2-yl]carbamic acid (PubChem CID 122530718) has the molecular formula C22H29N3O3 and a molecular weight of 383.49 g/mol. Its IUPAC name is [1-amino-3-[[4-phenyl-2-(2-phenylethyl)butanoyl]amino]propan-2-yl]carbamic acid.
| Compound Name | [1-amino-3-[[4-phenyl-2-(2-phenylethyl)butanoyl]amino]propan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 122530718 |
| Molecular Formula | C22H29N3O3 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | [1-amino-3-[[4-phenyl-2-(2-phenylethyl)butanoyl]amino]propan-2-yl]carbamic acid |
| SMILES | NCC(CNC(=O)C(CCc1ccccc1)CCc1ccccc1)NC(=O)O |
| InChI | InChI=1S/C22H29N3O3/c23-15-20(25-22(27)28)16-24-21(26)19(13-11-17-7-3-1-4-8-17)14-12-18-9-5-2-6-10-18/h1-10,19-20,25H,11-16,23H2,(H,24,26)(H,27,28) |
| InChIKey | VUSREBAQGCFWEE-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |