C26H27NO7 — CID 122534949
ethyl 2-[4-(cyclohexylmethoxy)-2-[(1,3-dioxoisoindol-2-yl)oxymethyl]phenyl]-2-oxoacetate (PubChem CID 122534949) has the molecular formula C26H27NO7 and a molecular weight of 465.50 g/mol. Its IUPAC name is ethyl 2-[4-(cyclohexylmethoxy)-2-[(1,3-dioxoisoindol-2-yl)oxymethyl]phenyl]-2-oxoacetate.
| Compound Name | ethyl 2-[4-(cyclohexylmethoxy)-2-[(1,3-dioxoisoindol-2-yl)oxymethyl]phenyl]-2-oxoacetate |
|---|---|
| PubChem CID | 122534949 |
| Molecular Formula | C26H27NO7 |
| Molecular Weight | 465.50 g/mol |
| Exact Mass | 465.18 |
| IUPAC Name | ethyl 2-[4-(cyclohexylmethoxy)-2-[(1,3-dioxoisoindol-2-yl)oxymethyl]phenyl]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)c1ccc(OCC2CCCCC2)cc1CON1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C26H27NO7/c1-2-32-26(31)23(28)20-13-12-19(33-15-17-8-4-3-5-9-17)14-18(20)16-34-27-24(29)21-10-6-7-11-22(21)25(27)30/h6-7,10-14,17H,2-5,8-9,15-16H2,1H3 |
| InChIKey | OYZMSPLMAQSOOT-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.50 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|