C21H17N3O6 — CID 134251635
ethyl 2-[7-[(1,3-dioxoisoindol-2-yl)oxymethyl]-1-methylindazol-6-yl]-2-oxoacetate (PubChem CID 134251635) has the molecular formula C21H17N3O6 and a molecular weight of 407.38 g/mol. Its IUPAC name is ethyl 2-[7-[(1,3-dioxoisoindol-2-yl)oxymethyl]-1-methylindazol-6-yl]-2-oxoacetate.
| Compound Name | ethyl 2-[7-[(1,3-dioxoisoindol-2-yl)oxymethyl]-1-methylindazol-6-yl]-2-oxoacetate |
|---|---|
| PubChem CID | 134251635 |
| Molecular Formula | C21H17N3O6 |
| Molecular Weight | 407.38 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | ethyl 2-[7-[(1,3-dioxoisoindol-2-yl)oxymethyl]-1-methylindazol-6-yl]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)c1ccc2cnn(C)c2c1CON1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C21H17N3O6/c1-3-29-21(28)18(25)13-9-8-12-10-22-23(2)17(12)16(13)11-30-24-19(26)14-6-4-5-7-15(14)20(24)27/h4-10H,3,11H2,1-2H3 |
| InChIKey | BXWMMSDTANHGCG-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 107.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.38 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|