C32H29ClN6O — CID 122537868
4-amino-N-[6-[[5-chloro-4-(1-phenylindol-3-yl)pyrimidin-2-yl]amino]spiro[3.3]heptan-2-yl]benzamide (PubChem CID 122537868) has the molecular formula C32H29ClN6O and a molecular weight of 549.08 g/mol. Its IUPAC name is 4-amino-N-[6-[[5-chloro-4-(1-phenylindol-3-yl)pyrimidin-2-yl]amino]spiro[3.3]heptan-2-yl]benzamide.
| Compound Name | 4-amino-N-[6-[[5-chloro-4-(1-phenylindol-3-yl)pyrimidin-2-yl]amino]spiro[3.3]heptan-2-yl]benzamide |
|---|---|
| PubChem CID | 122537868 |
| Molecular Formula | C32H29ClN6O |
| Molecular Weight | 549.08 g/mol |
| Exact Mass | 548.21 |
| IUPAC Name | 4-amino-N-[6-[[5-chloro-4-(1-phenylindol-3-yl)pyrimidin-2-yl]amino]spiro[3.3]heptan-2-yl]benzamide |
| SMILES | Nc1ccc(C(=O)NC2CC3(C2)CC(Nc2ncc(Cl)c(-c4cn(-c5ccccc5)c5ccccc45)n2)C3)cc1 |
| InChI | InChI=1S/C32H29ClN6O/c33-27-18-35-31(37-23-16-32(17-23)14-22(15-32)36-30(40)20-10-12-21(34)13-11-20)38-29(27)26-19-39(24-6-2-1-3-7-24)28-9-5-4-8-25(26)28/h1-13,18-19,22-23H,14-17,34H2,(H,36,40)(H,35,37,38) |
| InChIKey | YOCFTVJURFLPFK-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 97.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.08 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|