C24H21ClN4O — CID 129292952
(3R)-3-[[5-chloro-4-(1-phenylindol-3-yl)pyrimidin-2-yl]amino]cyclohexan-1-one (PubChem CID 129292952) has the molecular formula C24H21ClN4O and a molecular weight of 416.91 g/mol. Its IUPAC name is (3R)-3-[[5-chloro-4-(1-phenylindol-3-yl)pyrimidin-2-yl]amino]cyclohexan-1-one.
| Compound Name | (3R)-3-[[5-chloro-4-(1-phenylindol-3-yl)pyrimidin-2-yl]amino]cyclohexan-1-one |
|---|---|
| PubChem CID | 129292952 |
| Molecular Formula | C24H21ClN4O |
| Molecular Weight | 416.91 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | (3R)-3-[[5-chloro-4-(1-phenylindol-3-yl)pyrimidin-2-yl]amino]cyclohexan-1-one |
| SMILES | O=C1CCC[C@@H](Nc2ncc(Cl)c(-c3cn(-c4ccccc4)c4ccccc34)n2)C1 |
| InChI | InChI=1S/C24H21ClN4O/c25-21-14-26-24(27-16-7-6-10-18(30)13-16)28-23(21)20-15-29(17-8-2-1-3-9-17)22-12-5-4-11-19(20)22/h1-5,8-9,11-12,14-16H,6-7,10,13H2,(H,26,27,28)/t16-/m1/s1 |
| InChIKey | QYHXPIJMBJPTKW-MRXNPFEDSA-N |
| XLogP | 5.66 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.91 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |