C25H24ClN5 — CID 167376031
(3S)-N-[5-chloro-4-(1-phenylindol-3-yl)pyrimidin-2-yl]-1-azabicyclo[2.2.2]octan-3-amine (PubChem CID 167376031) has the molecular formula C25H24ClN5 and a molecular weight of 429.96 g/mol. Its IUPAC name is (3S)-N-[5-chloro-4-(1-phenylindol-3-yl)pyrimidin-2-yl]-1-azabicyclo[2.2.2]octan-3-amine.
| Compound Name | (3S)-N-[5-chloro-4-(1-phenylindol-3-yl)pyrimidin-2-yl]-1-azabicyclo[2.2.2]octan-3-amine |
|---|---|
| PubChem CID | 167376031 |
| Molecular Formula | C25H24ClN5 |
| Molecular Weight | 429.96 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | (3S)-N-[5-chloro-4-(1-phenylindol-3-yl)pyrimidin-2-yl]-1-azabicyclo[2.2.2]octan-3-amine |
| SMILES | Clc1cnc(N[C@@H]2CN3CCC2CC3)nc1-c1cn(-c2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C25H24ClN5/c26-21-14-27-25(28-22-16-30-12-10-17(22)11-13-30)29-24(21)20-15-31(18-6-2-1-3-7-18)23-9-5-4-8-19(20)23/h1-9,14-15,17,22H,10-13,16H2,(H,27,28,29)/t22-/m1/s1 |
| InChIKey | OTBCAQILQWZFJN-JOCHJYFZSA-N |
| XLogP | 5.25 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.96 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |