C16H11F4N3O2 — CID 122541534
5-[[(5R,6S,7S)-1-(1,1-difluoroethyl)-5,6-difluoro-7-hydroxy-6,7-dihydro-5H-cyclopenta[c]pyridin-4-yl]oxy]pyridine-3-carbonitrile (PubChem CID 122541534) has the molecular formula C16H11F4N3O2 and a molecular weight of 353.28 g/mol. Its IUPAC name is 5-[[(5R,6S,7S)-1-(1,1-difluoroethyl)-5,6-difluoro-7-hydroxy-6,7-dihydro-5H-cyclopenta[c]pyridin-4-yl]oxy]pyridine-3-carbonitrile.
| Compound Name | 5-[[(5R,6S,7S)-1-(1,1-difluoroethyl)-5,6-difluoro-7-hydroxy-6,7-dihydro-5H-cyclopenta[c]pyridin-4-yl]oxy]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 122541534 |
| Molecular Formula | C16H11F4N3O2 |
| Molecular Weight | 353.28 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | 5-[[(5R,6S,7S)-1-(1,1-difluoroethyl)-5,6-difluoro-7-hydroxy-6,7-dihydro-5H-cyclopenta[c]pyridin-4-yl]oxy]pyridine-3-carbonitrile |
| SMILES | CC(F)(F)c1ncc(Oc2cncc(C#N)c2)c2c1[C@H](O)[C@H](F)[C@@H]2F |
| InChI | InChI=1S/C16H11F4N3O2/c1-16(19,20)15-11-10(12(17)13(18)14(11)24)9(6-23-15)25-8-2-7(3-21)4-22-5-8/h2,4-6,12-14,24H,1H3/t12-,13-,14+/m1/s1 |
| InChIKey | ZETVZBUMCNKUMQ-MCIONIFRSA-N |
| XLogP | 3.65 |
| TPSA | 79.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.28 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |