About N-diphenylphosphanyl-N-methyl-N',N'-di(propan-2-yl)ethane-1,2-diamine
N-diphenylphosphanyl-N-methyl-N',N'-di(propan-2-yl)ethane-1,2-diamine (PubChem CID 122548842) has the molecular formula C21H31N2P
and a molecular weight of 342.47 g/mol. Its IUPAC name is N-diphenylphosphanyl-N-methyl-N',N'-di(propan-2-yl)ethane-1,2-diamine.
Molecular Properties
| Compound Name | N-diphenylphosphanyl-N-methyl-N',N'-di(propan-2-yl)ethane-1,2-diamine |
| PubChem CID | 122548842 |
| Molecular Formula | C21H31N2P |
| Molecular Weight | 342.47 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | N-diphenylphosphanyl-N-methyl-N',N'-di(propan-2-yl)ethane-1,2-diamine |
| SMILES | CC(C)N(CCN(C)P(c1ccccc1)c1ccccc1)C(C)C |
| InChI | InChI=1S/C21H31N2P/c1-18(2)23(19(3)4)17-16-22(5)24(20-12-8-6-9-13-20)21-14-10-7-11-15-21/h6-15,18-19H,16-17H2,1-5H3 |
| InChIKey | FDDSFTUJSJSXAQ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.47 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze N-diphenylphosphanyl-N-methyl-N',N'-di(propan-2-yl)ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-diphenylphosphanyl-N-methyl-N',N'-di(propan-2-yl)ethane-1,2-diamine?
The IUPAC name of N-diphenylphosphanyl-N-methyl-N',N'-di(propan-2-yl)ethane-1,2-diamine (CID 122548842) is N-diphenylphosphanyl-N-methyl-N',N'-di(propan-2-yl)ethane-1,2-diamine.
What is the SMILES notation for N-diphenylphosphanyl-N-methyl-N',N'-di(propan-2-yl)ethane-1,2-diamine?
The canonical SMILES for N-diphenylphosphanyl-N-methyl-N',N'-di(propan-2-yl)ethane-1,2-diamine is CC(C)N(CCN(C)P(c1ccccc1)c1ccccc1)C(C)C.
What is the InChIKey of N-diphenylphosphanyl-N-methyl-N',N'-di(propan-2-yl)ethane-1,2-diamine?
The InChIKey is FDDSFTUJSJSXAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H31N2P/c1-18(2)23(19(3)4)17-16-22(5)24(20-12-8-6-9-13-20)21-14-10-7-11-15-21/h6-15,18-19H,16-17H2,1-5H3.
What are the key properties of N-diphenylphosphanyl-N-methyl-N',N'-di(propan-2-yl)ethane-1,2-diamine?
N-diphenylphosphanyl-N-methyl-N',N'-di(propan-2-yl)ethane-1,2-diamine has a molecular weight of 342.47 g/mol, XLogP of 4.08, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-diphenylphosphanyl-N-methyl-N',N'-di(propan-2-yl)ethane-1,2-diamine is sourced from PubChem (CID 122548842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).