About N-methyl-N-[(N-methylanilino)-phenylphosphanyl]-N'-phenyl-N'-propan-2-ylmethanediamine
N-methyl-N-[(N-methylanilino)-phenylphosphanyl]-N'-phenyl-N'-propan-2-ylmethanediamine (PubChem CID 130232152) has the molecular formula C24H30N3P
and a molecular weight of 391.50 g/mol. Its IUPAC name is N-methyl-N-[(N-methylanilino)-phenylphosphanyl]-N'-phenyl-N'-propan-2-ylmethanediamine.
Molecular Properties
| Compound Name | N-methyl-N-[(N-methylanilino)-phenylphosphanyl]-N'-phenyl-N'-propan-2-ylmethanediamine |
| PubChem CID | 130232152 |
| Molecular Formula | C24H30N3P |
| Molecular Weight | 391.50 g/mol |
| Exact Mass | 391.22 |
| IUPAC Name | N-methyl-N-[(N-methylanilino)-phenylphosphanyl]-N'-phenyl-N'-propan-2-ylmethanediamine |
| SMILES | CC(C)N(CN(C)P(c1ccccc1)N(C)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H30N3P/c1-21(2)27(23-16-10-6-11-17-23)20-25(3)28(24-18-12-7-13-19-24)26(4)22-14-8-5-9-15-22/h5-19,21H,20H2,1-4H3 |
| InChIKey | CERGDDZXBAJCFJ-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 391.50 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-N-[(N-methylanilino)-phenylphosphanyl]-N'-phenyl-N'-propan-2-ylmethanediamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N-[(N-methylanilino)-phenylphosphanyl]-N'-phenyl-N'-propan-2-ylmethanediamine?
The IUPAC name of N-methyl-N-[(N-methylanilino)-phenylphosphanyl]-N'-phenyl-N'-propan-2-ylmethanediamine (CID 130232152) is N-methyl-N-[(N-methylanilino)-phenylphosphanyl]-N'-phenyl-N'-propan-2-ylmethanediamine.
What is the SMILES notation for N-methyl-N-[(N-methylanilino)-phenylphosphanyl]-N'-phenyl-N'-propan-2-ylmethanediamine?
The canonical SMILES for N-methyl-N-[(N-methylanilino)-phenylphosphanyl]-N'-phenyl-N'-propan-2-ylmethanediamine is CC(C)N(CN(C)P(c1ccccc1)N(C)c1ccccc1)c1ccccc1.
What is the InChIKey of N-methyl-N-[(N-methylanilino)-phenylphosphanyl]-N'-phenyl-N'-propan-2-ylmethanediamine?
The InChIKey is CERGDDZXBAJCFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H30N3P/c1-21(2)27(23-16-10-6-11-17-23)20-25(3)28(24-18-12-7-13-19-24)26(4)22-14-8-5-9-15-22/h5-19,21H,20H2,1-4H3.
What are the key properties of N-methyl-N-[(N-methylanilino)-phenylphosphanyl]-N'-phenyl-N'-propan-2-ylmethanediamine?
N-methyl-N-[(N-methylanilino)-phenylphosphanyl]-N'-phenyl-N'-propan-2-ylmethanediamine has a molecular weight of 391.50 g/mol, XLogP of 5.56, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N-[(N-methylanilino)-phenylphosphanyl]-N'-phenyl-N'-propan-2-ylmethanediamine is sourced from PubChem (CID 130232152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).