C24H30N2P2 — CID 121401614
N-diphenylphosphanyl-N-[[ethyl(methyl)amino]-phenylphosphanyl]propan-2-amine (PubChem CID 121401614) has the molecular formula C24H30N2P2 and a molecular weight of 408.47 g/mol. Its IUPAC name is N-diphenylphosphanyl-N-[[ethyl(methyl)amino]-phenylphosphanyl]propan-2-amine.
| Compound Name | N-diphenylphosphanyl-N-[[ethyl(methyl)amino]-phenylphosphanyl]propan-2-amine |
|---|---|
| PubChem CID | 121401614 |
| Molecular Formula | C24H30N2P2 |
| Molecular Weight | 408.47 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | N-diphenylphosphanyl-N-[[ethyl(methyl)amino]-phenylphosphanyl]propan-2-amine |
| SMILES | CCN(C)P(c1ccccc1)N(C(C)C)P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H30N2P2/c1-5-25(4)28(24-19-13-8-14-20-24)26(21(2)3)27(22-15-9-6-10-16-22)23-17-11-7-12-18-23/h6-21H,5H2,1-4H3 |
| InChIKey | DMHUSDNTTLBUIM-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.47 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|