C64H73N3P4 — CID 129083275
1-N-[4-[bis(diphenylphosphanyl)amino]pentyl]-7-N,7-N-bis(diphenylphosphanyl)-1-N-ethyl-4-methyloctane-1,7-diamine (PubChem CID 129083275) has the molecular formula C64H73N3P4 and a molecular weight of 1008.21 g/mol. Its IUPAC name is 1-N-[4-[bis(diphenylphosphanyl)amino]pentyl]-7-N,7-N-bis(diphenylphosphanyl)-1-N-ethyl-4-methyloctane-1,7-diamine.
| Compound Name | 1-N-[4-[bis(diphenylphosphanyl)amino]pentyl]-7-N,7-N-bis(diphenylphosphanyl)-1-N-ethyl-4-methyloctane-1,7-diamine |
|---|---|
| PubChem CID | 129083275 |
| Molecular Formula | C64H73N3P4 |
| Molecular Weight | 1008.21 g/mol |
| Exact Mass | 1007.48 |
| IUPAC Name | 1-N-[4-[bis(diphenylphosphanyl)amino]pentyl]-7-N,7-N-bis(diphenylphosphanyl)-1-N-ethyl-4-methyloctane-1,7-diamine |
| SMILES | CCN(CCCC(C)CCC(C)N(P(c1ccccc1)c1ccccc1)P(c1ccccc1)c1ccccc1)CCCC(C)N(P(c1ccccc1)c1ccccc1)P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C64H73N3P4/c1-5-65(53-31-33-55(3)66(68(57-34-14-6-15-35-57)58-36-16-7-17-37-58)69(59-38-18-8-19-39-59)60-40-20-9-21-41-60)52-30-32-54(2)50-51-56(4)67(70(61-42-22-10-23-43-61)62-44-24-11-25-45-62)71(63-46-26-12-27-47-63)64-48-28-13-29-49-64/h6-29,34-49,54-56H,5,30-33,50-53H2,1-4H3 |
| InChIKey | XXLUKXCMROLZII-UHFFFAOYSA-N |
| XLogP | 13.86 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1008.21 |
| LogP ≤ 5 | 13.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|