C32H29NP2 — CID 11225572
(1S)-N,N-bis(diphenylphosphanyl)-1-phenylethanamine (PubChem CID 11225572) has the molecular formula C32H29NP2 and a molecular weight of 489.54 g/mol. Its IUPAC name is (1S)-N,N-bis(diphenylphosphanyl)-1-phenylethanamine.
| Compound Name | (1S)-N,N-bis(diphenylphosphanyl)-1-phenylethanamine |
|---|---|
| PubChem CID | 11225572 |
| Molecular Formula | C32H29NP2 |
| Molecular Weight | 489.54 g/mol |
| Exact Mass | 489.18 |
| IUPAC Name | (1S)-N,N-bis(diphenylphosphanyl)-1-phenylethanamine |
| SMILES | C[C@@H](c1ccccc1)N(P(c1ccccc1)c1ccccc1)P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H29NP2/c1-27(28-17-7-2-8-18-28)33(34(29-19-9-3-10-20-29)30-21-11-4-12-22-30)35(31-23-13-5-14-24-31)32-25-15-6-16-26-32/h2-27H,1H3/t27-/m0/s1 |
| InChIKey | GYHSCFVRAMOHIY-MHZLTWQESA-N |
| XLogP | 7.15 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.54 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|