C12H13ClF3N3O3S — CID 122549445
N-[4-(4-chloropiperazin-1-yl)sulfonylphenyl]-2,2,2-trifluoroacetamide (PubChem CID 122549445) has the molecular formula C12H13ClF3N3O3S and a molecular weight of 371.77 g/mol. Its IUPAC name is N-[4-(4-chloropiperazin-1-yl)sulfonylphenyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[4-(4-chloropiperazin-1-yl)sulfonylphenyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 122549445 |
| Molecular Formula | C12H13ClF3N3O3S |
| Molecular Weight | 371.77 g/mol |
| Exact Mass | 371.03 |
| IUPAC Name | N-[4-(4-chloropiperazin-1-yl)sulfonylphenyl]-2,2,2-trifluoroacetamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)N2CCN(Cl)CC2)cc1)C(F)(F)F |
| InChI | InChI=1S/C12H13ClF3N3O3S/c13-18-5-7-19(8-6-18)23(21,22)10-3-1-9(2-4-10)17-11(20)12(14,15)16/h1-4H,5-8H2,(H,17,20) |
| InChIKey | GIDFQIYKMSSBAJ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.77 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|