C9H18F3NO4S — CID 122553764
1-(2-methoxyethyl)-1-methylpyrrolidin-1-ium;trifluoromethanesulfonate (PubChem CID 122553764) has the molecular formula C9H18F3NO4S and a molecular weight of 293.31 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-1-methylpyrrolidin-1-ium;trifluoromethanesulfonate.
| Compound Name | 1-(2-methoxyethyl)-1-methylpyrrolidin-1-ium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 122553764 |
| Molecular Formula | C9H18F3NO4S |
| Molecular Weight | 293.31 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | 1-(2-methoxyethyl)-1-methylpyrrolidin-1-ium;trifluoromethanesulfonate |
| SMILES | COCC[N+]1(C)CCCC1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C8H18NO.CHF3O3S/c1-9(7-8-10-2)5-3-4-6-9;2-1(3,4)8(5,6)7/h3-8H2,1-2H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | UIULRTSRCWHAML-UHFFFAOYSA-M |
| XLogP | 0.92 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.31 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|