C17H24N2O3 — CID 122561212
(4aS,8aR)-N-[(2,4-dihydroxyphenyl)methyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2-carboxamide (PubChem CID 122561212) has the molecular formula C17H24N2O3 and a molecular weight of 304.39 g/mol. Its IUPAC name is (4aS,8aR)-N-[(2,4-dihydroxyphenyl)methyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2-carboxamide.
| Compound Name | (4aS,8aR)-N-[(2,4-dihydroxyphenyl)methyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2-carboxamide |
|---|---|
| PubChem CID | 122561212 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | (4aS,8aR)-N-[(2,4-dihydroxyphenyl)methyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2-carboxamide |
| SMILES | O=C(NCc1ccc(O)cc1O)N1CC[C@@H]2CCCC[C@H]2C1 |
| InChI | InChI=1S/C17H24N2O3/c20-15-6-5-13(16(21)9-15)10-18-17(22)19-8-7-12-3-1-2-4-14(12)11-19/h5-6,9,12,14,20-21H,1-4,7-8,10-11H2,(H,18,22)/t12-,14-/m0/s1 |
| InChIKey | DFHRDLGQIYKMJW-JSGCOSHPSA-N |
| XLogP | 2.82 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|