C23H27NO3 — CID 119060389
[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-[4-[4-hydroxy-3-(hydroxymethyl)phenyl]phenyl]methanone (PubChem CID 119060389) has the molecular formula C23H27NO3 and a molecular weight of 365.47 g/mol. Its IUPAC name is [(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-[4-[4-hydroxy-3-(hydroxymethyl)phenyl]phenyl]methanone.
| Compound Name | [(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-[4-[4-hydroxy-3-(hydroxymethyl)phenyl]phenyl]methanone |
|---|---|
| PubChem CID | 119060389 |
| Molecular Formula | C23H27NO3 |
| Molecular Weight | 365.47 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | [(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-[4-[4-hydroxy-3-(hydroxymethyl)phenyl]phenyl]methanone |
| SMILES | O=C(c1ccc(-c2ccc(O)c(CO)c2)cc1)N1CC[C@@H]2CCCC[C@H]2C1 |
| InChI | InChI=1S/C23H27NO3/c25-15-21-13-19(9-10-22(21)26)17-5-7-18(8-6-17)23(27)24-12-11-16-3-1-2-4-20(16)14-24/h5-10,13,16,20,25-26H,1-4,11-12,14-15H2/t16-,20-/m0/s1 |
| InChIKey | SHYJFCLCVPCTHD-JXFKEZNVSA-N |
| XLogP | 4.20 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.47 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |